C19H27N3O4 — CID 68539164
(2S)-2-amino-3-(3-cyanophenyl)propanoic acid;2-[1-(aminomethyl)cyclohexyl]acetic acid (PubChem CID 68539164) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is (2S)-2-amino-3-(3-cyanophenyl)propanoic acid;2-[1-(aminomethyl)cyclohexyl]acetic acid.
| Compound Name | (2S)-2-amino-3-(3-cyanophenyl)propanoic acid;2-[1-(aminomethyl)cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 68539164 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (2S)-2-amino-3-(3-cyanophenyl)propanoic acid;2-[1-(aminomethyl)cyclohexyl]acetic acid |
| SMILES | N#Cc1cccc(C[C@H](N)C(=O)O)c1.NCC1(CC(=O)O)CCCCC1 |
| InChI | InChI=1S/C10H10N2O2.C9H17NO2/c11-6-8-3-1-2-7(4-8)5-9(12)10(13)14;10-7-9(6-8(11)12)4-2-1-3-5-9/h1-4,9H,5,12H2,(H,13,14);1-7,10H2,(H,11,12)/t9-;/m0./s1 |
| InChIKey | KZWXBPRQAXFDKP-FVGYRXGTSA-N |
| XLogP | 1.88 |
| TPSA | 150.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |