About 2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrobromide
2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrobromide (PubChem CID 66875980) has the molecular formula C9H18BrNO2
and a molecular weight of 252.15 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrobromide.
Molecular Properties
| Compound Name | 2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrobromide |
| PubChem CID | 66875980 |
| Molecular Formula | C9H18BrNO2 |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrobromide |
| SMILES | Br.NCC1(CC(=O)O)CCCCC1 |
| InChI | InChI=1S/C9H17NO2.BrH/c10-7-9(6-8(11)12)4-2-1-3-5-9;/h1-7,10H2,(H,11,12);1H |
| InChIKey | DJOITRXLMIEMFM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrobromide?
The IUPAC name of 2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrobromide (CID 66875980) is 2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrobromide.
What is the SMILES notation for 2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrobromide?
The canonical SMILES for 2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrobromide is Br.NCC1(CC(=O)O)CCCCC1.
What is the InChIKey of 2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrobromide?
The InChIKey is DJOITRXLMIEMFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.BrH/c10-7-9(6-8(11)12)4-2-1-3-5-9;/h1-7,10H2,(H,11,12);1H.
What are the key properties of 2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrobromide?
2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrobromide has a molecular weight of 252.15 g/mol, XLogP of 1.95, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrobromide is sourced from PubChem (CID 66875980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).