About 2-[1-(aminomethyl)cyclohexyl]acetic acid;2-carboxyphenolate
2-[1-(aminomethyl)cyclohexyl]acetic acid;2-carboxyphenolate (PubChem CID 86759529) has the molecular formula C16H22NO5-
and a molecular weight of 308.35 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclohexyl]acetic acid;2-carboxyphenolate.
Molecular Properties
| Compound Name | 2-[1-(aminomethyl)cyclohexyl]acetic acid;2-carboxyphenolate |
| PubChem CID | 86759529 |
| Molecular Formula | C16H22NO5- |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-[1-(aminomethyl)cyclohexyl]acetic acid;2-carboxyphenolate |
| SMILES | NCC1(CC(=O)O)CCCCC1.O=C(O)c1ccccc1[O-] |
| InChI | InChI=1S/C9H17NO2.C7H6O3/c10-7-9(6-8(11)12)4-2-1-3-5-9;8-6-4-2-1-3-5(6)7(9)10/h1-7,10H2,(H,11,12);1-4,8H,(H,9,10)/p-1 |
| InChIKey | HTSNQXBKTXXQGW-UHFFFAOYSA-M |
| XLogP | 1.83 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-(aminomethyl)cyclohexyl]acetic acid;2-carboxyphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(aminomethyl)cyclohexyl]acetic acid;2-carboxyphenolate?
The IUPAC name of 2-[1-(aminomethyl)cyclohexyl]acetic acid;2-carboxyphenolate (CID 86759529) is 2-[1-(aminomethyl)cyclohexyl]acetic acid;2-carboxyphenolate.
What is the SMILES notation for 2-[1-(aminomethyl)cyclohexyl]acetic acid;2-carboxyphenolate?
The canonical SMILES for 2-[1-(aminomethyl)cyclohexyl]acetic acid;2-carboxyphenolate is NCC1(CC(=O)O)CCCCC1.O=C(O)c1ccccc1[O-].
What is the InChIKey of 2-[1-(aminomethyl)cyclohexyl]acetic acid;2-carboxyphenolate?
The InChIKey is HTSNQXBKTXXQGW-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H17NO2.C7H6O3/c10-7-9(6-8(11)12)4-2-1-3-5-9;8-6-4-2-1-3-5(6)7(9)10/h1-7,10H2,(H,11,12);1-4,8H,(H,9,10)/p-1.
What are the key properties of 2-[1-(aminomethyl)cyclohexyl]acetic acid;2-carboxyphenolate?
2-[1-(aminomethyl)cyclohexyl]acetic acid;2-carboxyphenolate has a molecular weight of 308.35 g/mol, XLogP of 1.83, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(aminomethyl)cyclohexyl]acetic acid;2-carboxyphenolate is sourced from PubChem (CID 86759529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).