About copper bis(2-carboxyphenolate)
copper bis(2-carboxyphenolate) (PubChem CID 54683201) has the molecular formula C14H10CuO6
and a molecular weight of 337.77 g/mol. Its IUPAC name is copper bis(2-carboxyphenolate).
Molecular Properties
| Compound Name | copper bis(2-carboxyphenolate) |
| PubChem CID | 54683201 |
| Molecular Formula | C14H10CuO6 |
| Molecular Weight | 337.77 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | copper bis(2-carboxyphenolate) |
| SMILES | O=C(O)c1ccccc1[O-].O=C(O)c1ccccc1[O-].[Cu+2] |
| InChI | InChI=1S/2C7H6O3.Cu/c2*8-6-4-2-1-3-5(6)7(9)10;/h2*1-4,8H,(H,9,10);/q;;+2/p-2 |
| InChIKey | CMRVDFLZXRTMTH-UHFFFAOYSA-L |
| XLogP | 0.91 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.77 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze copper bis(2-carboxyphenolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis(2-carboxyphenolate)?
The IUPAC name of copper bis(2-carboxyphenolate) (CID 54683201) is copper bis(2-carboxyphenolate).
What is the SMILES notation for copper bis(2-carboxyphenolate)?
The canonical SMILES for copper bis(2-carboxyphenolate) is O=C(O)c1ccccc1[O-].O=C(O)c1ccccc1[O-].[Cu+2].
What is the InChIKey of copper bis(2-carboxyphenolate)?
The InChIKey is CMRVDFLZXRTMTH-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H6O3.Cu/c2*8-6-4-2-1-3-5(6)7(9)10;/h2*1-4,8H,(H,9,10);/q;;+2/p-2.
What are the key properties of copper bis(2-carboxyphenolate)?
copper bis(2-carboxyphenolate) has a molecular weight of 337.77 g/mol, XLogP of 0.91, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis(2-carboxyphenolate) is sourced from PubChem (CID 54683201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).