About potassium 2-carboxyphenolate
potassium 2-carboxyphenolate (PubChem CID 23689489) has the molecular formula C7H5KO3
and a molecular weight of 176.21 g/mol. Its IUPAC name is potassium 2-carboxyphenolate.
Molecular Properties
| Compound Name | potassium 2-carboxyphenolate |
| PubChem CID | 23689489 |
| Molecular Formula | C7H5KO3 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 175.99 |
| IUPAC Name | potassium 2-carboxyphenolate |
| SMILES | O=C(O)c1ccccc1[O-].[K+] |
| InChI | InChI=1S/C7H6O3.K/c8-6-4-2-1-3-5(6)7(9)10;/h1-4,8H,(H,9,10);/q;+1/p-1 |
| InChIKey | FRMWBRPWYBNAFB-UHFFFAOYSA-M |
| XLogP | -2.54 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium 2-carboxyphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-carboxyphenolate?
The IUPAC name of potassium 2-carboxyphenolate (CID 23689489) is potassium 2-carboxyphenolate.
What is the SMILES notation for potassium 2-carboxyphenolate?
The canonical SMILES for potassium 2-carboxyphenolate is O=C(O)c1ccccc1[O-].[K+].
What is the InChIKey of potassium 2-carboxyphenolate?
The InChIKey is FRMWBRPWYBNAFB-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O3.K/c8-6-4-2-1-3-5(6)7(9)10;/h1-4,8H,(H,9,10);/q;+1/p-1.
What are the key properties of potassium 2-carboxyphenolate?
potassium 2-carboxyphenolate has a molecular weight of 176.21 g/mol, XLogP of -2.54, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-carboxyphenolate is sourced from PubChem (CID 23689489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).