About 2-carboxyphenolate;gold(1+)
2-carboxyphenolate;gold(1+) (PubChem CID 54682314) has the molecular formula C7H5AuO3
and a molecular weight of 334.08 g/mol. Its IUPAC name is 2-carboxyphenolate;gold(1+).
Molecular Properties
| Compound Name | 2-carboxyphenolate;gold(1+) |
| PubChem CID | 54682314 |
| Molecular Formula | C7H5AuO3 |
| Molecular Weight | 334.08 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 2-carboxyphenolate;gold(1+) |
| SMILES | O=C(O)c1ccccc1[O-].[Au+] |
| InChI | InChI=1S/C7H6O3.Au/c8-6-4-2-1-3-5(6)7(9)10;/h1-4,8H,(H,9,10);/q;+1/p-1 |
| InChIKey | LDGNAVCEXCJQON-UHFFFAOYSA-M |
| XLogP | 0.46 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.08 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-carboxyphenolate;gold(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxyphenolate;gold(1+)?
The IUPAC name of 2-carboxyphenolate;gold(1+) (CID 54682314) is 2-carboxyphenolate;gold(1+).
What is the SMILES notation for 2-carboxyphenolate;gold(1+)?
The canonical SMILES for 2-carboxyphenolate;gold(1+) is O=C(O)c1ccccc1[O-].[Au+].
What is the InChIKey of 2-carboxyphenolate;gold(1+)?
The InChIKey is LDGNAVCEXCJQON-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O3.Au/c8-6-4-2-1-3-5(6)7(9)10;/h1-4,8H,(H,9,10);/q;+1/p-1.
What are the key properties of 2-carboxyphenolate;gold(1+)?
2-carboxyphenolate;gold(1+) has a molecular weight of 334.08 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxyphenolate;gold(1+) is sourced from PubChem (CID 54682314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).