About 2-carboxyphenolate carbonate
2-carboxyphenolate carbonate (PubChem CID 54676053) has the molecular formula C8H5O6-3
and a molecular weight of 197.12 g/mol. Its IUPAC name is 2-carboxyphenolate carbonate.
Molecular Properties
| Compound Name | 2-carboxyphenolate carbonate |
| PubChem CID | 54676053 |
| Molecular Formula | C8H5O6-3 |
| Molecular Weight | 197.12 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 2-carboxyphenolate carbonate |
| SMILES | O=C(O)c1ccccc1[O-].O=C([O-])[O-] |
| InChI | InChI=1S/C7H6O3.CH2O3/c8-6-4-2-1-3-5(6)7(9)10;2-1(3)4/h1-4,8H,(H,9,10);(H2,2,3,4)/p-3 |
| InChIKey | OZZVTYISHDDTTJ-UHFFFAOYSA-K |
| XLogP | -1.99 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.12 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-carboxyphenolate carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxyphenolate carbonate?
The IUPAC name of 2-carboxyphenolate carbonate (CID 54676053) is 2-carboxyphenolate carbonate.
What is the SMILES notation for 2-carboxyphenolate carbonate?
The canonical SMILES for 2-carboxyphenolate carbonate is O=C(O)c1ccccc1[O-].O=C([O-])[O-].
What is the InChIKey of 2-carboxyphenolate carbonate?
The InChIKey is OZZVTYISHDDTTJ-UHFFFAOYSA-K. The full InChI is InChI=1S/C7H6O3.CH2O3/c8-6-4-2-1-3-5(6)7(9)10;2-1(3)4/h1-4,8H,(H,9,10);(H2,2,3,4)/p-3.
What are the key properties of 2-carboxyphenolate carbonate?
2-carboxyphenolate carbonate has a molecular weight of 197.12 g/mol, XLogP of -1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxyphenolate carbonate is sourced from PubChem (CID 54676053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).