About 2-carboxyphenolate;ethane;methane
2-carboxyphenolate;ethane;methane (PubChem CID 158005371) has the molecular formula C11H19O3-
and a molecular weight of 199.27 g/mol. Its IUPAC name is 2-carboxyphenolate;ethane;methane.
Molecular Properties
| Compound Name | 2-carboxyphenolate;ethane;methane |
| PubChem CID | 158005371 |
| Molecular Formula | C11H19O3- |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 2-carboxyphenolate;ethane;methane |
| SMILES | C.C.CC.O=C(O)c1ccccc1[O-] |
| InChI | InChI=1S/C7H6O3.C2H6.2CH4/c8-6-4-2-1-3-5(6)7(9)10;1-2;;/h1-4,8H,(H,9,10);1-2H3;2*1H4/p-1 |
| InChIKey | FEFNUMJXAAZKMB-UHFFFAOYSA-M |
| XLogP | 2.76 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-carboxyphenolate;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxyphenolate;ethane;methane?
The IUPAC name of 2-carboxyphenolate;ethane;methane (CID 158005371) is 2-carboxyphenolate;ethane;methane.
What is the SMILES notation for 2-carboxyphenolate;ethane;methane?
The canonical SMILES for 2-carboxyphenolate;ethane;methane is C.C.CC.O=C(O)c1ccccc1[O-].
What is the InChIKey of 2-carboxyphenolate;ethane;methane?
The InChIKey is FEFNUMJXAAZKMB-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O3.C2H6.2CH4/c8-6-4-2-1-3-5(6)7(9)10;1-2;;/h1-4,8H,(H,9,10);1-2H3;2*1H4/p-1.
What are the key properties of 2-carboxyphenolate;ethane;methane?
2-carboxyphenolate;ethane;methane has a molecular weight of 199.27 g/mol, XLogP of 2.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxyphenolate;ethane;methane is sourced from PubChem (CID 158005371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).