About copper;2-aminoacetate;2-carboxyphenolate
copper;2-aminoacetate;2-carboxyphenolate (PubChem CID 54741776) has the molecular formula C9H9CuNO5
and a molecular weight of 274.72 g/mol. Its IUPAC name is copper;2-aminoacetate;2-carboxyphenolate.
Molecular Properties
| Compound Name | copper;2-aminoacetate;2-carboxyphenolate |
| PubChem CID | 54741776 |
| Molecular Formula | C9H9CuNO5 |
| Molecular Weight | 274.72 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | copper;2-aminoacetate;2-carboxyphenolate |
| SMILES | NCC(=O)[O-].O=C(O)c1ccccc1[O-].[Cu+2] |
| InChI | InChI=1S/C7H6O3.C2H5NO2.Cu/c8-6-4-2-1-3-5(6)7(9)10;3-1-2(4)5;/h1-4,8H,(H,9,10);1,3H2,(H,4,5);/q;;+2/p-2 |
| InChIKey | IGVJBNOWYCUJOG-UHFFFAOYSA-L |
| XLogP | -1.85 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.72 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze copper;2-aminoacetate;2-carboxyphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;2-aminoacetate;2-carboxyphenolate?
The IUPAC name of copper;2-aminoacetate;2-carboxyphenolate (CID 54741776) is copper;2-aminoacetate;2-carboxyphenolate.
What is the SMILES notation for copper;2-aminoacetate;2-carboxyphenolate?
The canonical SMILES for copper;2-aminoacetate;2-carboxyphenolate is NCC(=O)[O-].O=C(O)c1ccccc1[O-].[Cu+2].
What is the InChIKey of copper;2-aminoacetate;2-carboxyphenolate?
The InChIKey is IGVJBNOWYCUJOG-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H6O3.C2H5NO2.Cu/c8-6-4-2-1-3-5(6)7(9)10;3-1-2(4)5;/h1-4,8H,(H,9,10);1,3H2,(H,4,5);/q;;+2/p-2.
What are the key properties of copper;2-aminoacetate;2-carboxyphenolate?
copper;2-aminoacetate;2-carboxyphenolate has a molecular weight of 274.72 g/mol, XLogP of -1.85, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for copper;2-aminoacetate;2-carboxyphenolate is sourced from PubChem (CID 54741776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).