About sodium;2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrate
sodium;2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrate (PubChem CID 18668043) has the molecular formula C9H19NNaO3+
and a molecular weight of 212.24 g/mol. Its IUPAC name is sodium;2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrate.
Molecular Properties
| Compound Name | sodium;2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrate |
| PubChem CID | 18668043 |
| Molecular Formula | C9H19NNaO3+ |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | sodium;2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrate |
| SMILES | NCC1(CC(=O)O)CCCCC1.O.[Na+] |
| InChI | InChI=1S/C9H17NO2.Na.H2O/c10-7-9(6-8(11)12)4-2-1-3-5-9;;/h1-7,10H2,(H,11,12);;1H2/q;+1; |
| InChIKey | QRRPNEKHWLHEHN-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrate?
The IUPAC name of sodium;2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrate (CID 18668043) is sodium;2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrate.
What is the SMILES notation for sodium;2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrate?
The canonical SMILES for sodium;2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrate is NCC1(CC(=O)O)CCCCC1.O.[Na+].
What is the InChIKey of sodium;2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrate?
The InChIKey is QRRPNEKHWLHEHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.Na.H2O/c10-7-9(6-8(11)12)4-2-1-3-5-9;;/h1-7,10H2,(H,11,12);;1H2/q;+1;.
What are the key properties of sodium;2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrate?
sodium;2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrate has a molecular weight of 212.24 g/mol, XLogP of -2.45, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-[1-(aminomethyl)cyclohexyl]acetic acid;hydrate is sourced from PubChem (CID 18668043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).