C18H27IN2O4 — CID 68535655
(2S)-2-amino-3-(4-iodophenyl)propanoic acid;2-[1-(aminomethyl)cyclohexyl]acetic acid (PubChem CID 68535655) has the molecular formula C18H27IN2O4 and a molecular weight of 462.33 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-iodophenyl)propanoic acid;2-[1-(aminomethyl)cyclohexyl]acetic acid.
| Compound Name | (2S)-2-amino-3-(4-iodophenyl)propanoic acid;2-[1-(aminomethyl)cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 68535655 |
| Molecular Formula | C18H27IN2O4 |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | (2S)-2-amino-3-(4-iodophenyl)propanoic acid;2-[1-(aminomethyl)cyclohexyl]acetic acid |
| SMILES | NCC1(CC(=O)O)CCCCC1.N[C@@H](Cc1ccc(I)cc1)C(=O)O |
| InChI | InChI=1S/C9H10INO2.C9H17NO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13;10-7-9(6-8(11)12)4-2-1-3-5-9/h1-4,8H,5,11H2,(H,12,13);1-7,10H2,(H,11,12)/t8-;/m0./s1 |
| InChIKey | ZYMRVNHCQBSQQM-QRPNPIFTSA-N |
| XLogP | 2.62 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|