C20H30N2O4 — CID 10292134
2-[1-[[[(2R)-2-amino-3-(4-ethoxyphenyl)propanoyl]amino]methyl]cyclohexyl]acetic acid (PubChem CID 10292134) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[1-[[[(2R)-2-amino-3-(4-ethoxyphenyl)propanoyl]amino]methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[[[(2R)-2-amino-3-(4-ethoxyphenyl)propanoyl]amino]methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 10292134 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 2-[1-[[[(2R)-2-amino-3-(4-ethoxyphenyl)propanoyl]amino]methyl]cyclohexyl]acetic acid |
| SMILES | CCOc1ccc(C[C@@H](N)C(=O)NCC2(CC(=O)O)CCCCC2)cc1 |
| InChI | InChI=1S/C20H30N2O4/c1-2-26-16-8-6-15(7-9-16)12-17(21)19(25)22-14-20(13-18(23)24)10-4-3-5-11-20/h6-9,17H,2-5,10-14,21H2,1H3,(H,22,25)(H,23,24)/t17-/m1/s1 |
| InChIKey | FSUODTOOQOOMSU-QGZVFWFLSA-N |
| XLogP | 2.50 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |