C15H19IO3 — CID 61069302
2-[1-[2-hydroxy-2-(4-iodophenyl)ethyl]cyclopentyl]acetic acid (PubChem CID 61069302) has the molecular formula C15H19IO3 and a molecular weight of 374.22 g/mol. Its IUPAC name is 2-[1-[2-hydroxy-2-(4-iodophenyl)ethyl]cyclopentyl]acetic acid.
| Compound Name | 2-[1-[2-hydroxy-2-(4-iodophenyl)ethyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 61069302 |
| Molecular Formula | C15H19IO3 |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 2-[1-[2-hydroxy-2-(4-iodophenyl)ethyl]cyclopentyl]acetic acid |
| SMILES | O=C(O)CC1(CC(O)c2ccc(I)cc2)CCCC1 |
| InChI | InChI=1S/C15H19IO3/c16-12-5-3-11(4-6-12)13(17)9-15(10-14(18)19)7-1-2-8-15/h3-6,13,17H,1-2,7-10H2,(H,18,19) |
| InChIKey | PHCVSXCUNHNPBV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|