C14H19BrO3S — CID 102828999
2-[1-[2-(4-bromo-5-methylthiophen-2-yl)-2-hydroxyethyl]cyclopentyl]acetic acid (PubChem CID 102828999) has the molecular formula C14H19BrO3S and a molecular weight of 347.27 g/mol. Its IUPAC name is 2-[1-[2-(4-bromo-5-methylthiophen-2-yl)-2-hydroxyethyl]cyclopentyl]acetic acid.
| Compound Name | 2-[1-[2-(4-bromo-5-methylthiophen-2-yl)-2-hydroxyethyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 102828999 |
| Molecular Formula | C14H19BrO3S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 2-[1-[2-(4-bromo-5-methylthiophen-2-yl)-2-hydroxyethyl]cyclopentyl]acetic acid |
| SMILES | Cc1sc(C(O)CC2(CC(=O)O)CCCC2)cc1Br |
| InChI | InChI=1S/C14H19BrO3S/c1-9-10(15)6-12(19-9)11(16)7-14(8-13(17)18)4-2-3-5-14/h6,11,16H,2-5,7-8H2,1H3,(H,17,18) |
| InChIKey | RKXHWNHZARYKMJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |