C8H11BrO3S2 — CID 102834626
1-(4-bromo-5-methylthiophen-2-yl)-2-methylsulfonylethanol (PubChem CID 102834626) has the molecular formula C8H11BrO3S2 and a molecular weight of 299.21 g/mol. Its IUPAC name is 1-(4-bromo-5-methylthiophen-2-yl)-2-methylsulfonylethanol.
| Compound Name | 1-(4-bromo-5-methylthiophen-2-yl)-2-methylsulfonylethanol |
|---|---|
| PubChem CID | 102834626 |
| Molecular Formula | C8H11BrO3S2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 297.93 |
| IUPAC Name | 1-(4-bromo-5-methylthiophen-2-yl)-2-methylsulfonylethanol |
| SMILES | Cc1sc(C(O)CS(C)(=O)=O)cc1Br |
| InChI | InChI=1S/C8H11BrO3S2/c1-5-6(9)3-8(13-5)7(10)4-14(2,11)12/h3,7,10H,4H2,1-2H3 |
| InChIKey | CGLKEEZNIKAYAK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |