C7H8BrNO2S — CID 102843536
2-(4-bromo-5-methylthiophen-2-yl)-2-hydroxyacetamide (PubChem CID 102843536) has the molecular formula C7H8BrNO2S and a molecular weight of 250.12 g/mol. Its IUPAC name is 2-(4-bromo-5-methylthiophen-2-yl)-2-hydroxyacetamide.
| Compound Name | 2-(4-bromo-5-methylthiophen-2-yl)-2-hydroxyacetamide |
|---|---|
| PubChem CID | 102843536 |
| Molecular Formula | C7H8BrNO2S |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 248.95 |
| IUPAC Name | 2-(4-bromo-5-methylthiophen-2-yl)-2-hydroxyacetamide |
| SMILES | Cc1sc(C(O)C(N)=O)cc1Br |
| InChI | InChI=1S/C7H8BrNO2S/c1-3-4(8)2-5(12-3)6(10)7(9)11/h2,6,10H,1H3,(H2,9,11) |
| InChIKey | QCBIHSPRUYOMJA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |