C7H6Br2F2S — CID 103514682
3-bromo-5-(1-bromo-2,2-difluoroethyl)-2-methylthiophene (PubChem CID 103514682) has the molecular formula C7H6Br2F2S and a molecular weight of 320.00 g/mol. Its IUPAC name is 3-bromo-5-(1-bromo-2,2-difluoroethyl)-2-methylthiophene.
| Compound Name | 3-bromo-5-(1-bromo-2,2-difluoroethyl)-2-methylthiophene |
|---|---|
| PubChem CID | 103514682 |
| Molecular Formula | C7H6Br2F2S |
| Molecular Weight | 320.00 g/mol |
| Exact Mass | 317.85 |
| IUPAC Name | 3-bromo-5-(1-bromo-2,2-difluoroethyl)-2-methylthiophene |
| SMILES | Cc1sc(C(Br)C(F)F)cc1Br |
| InChI | InChI=1S/C7H6Br2F2S/c1-3-4(8)2-5(12-3)6(9)7(10)11/h2,6-7H,1H3 |
| InChIKey | UTXUFVXPRJODON-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.00 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|