C12H7Br2F3S — CID 102835931
3-bromo-5-[bromo-(3,4,5-trifluorophenyl)methyl]-2-methylthiophene (PubChem CID 102835931) has the molecular formula C12H7Br2F3S and a molecular weight of 400.06 g/mol. Its IUPAC name is 3-bromo-5-[bromo-(3,4,5-trifluorophenyl)methyl]-2-methylthiophene.
| Compound Name | 3-bromo-5-[bromo-(3,4,5-trifluorophenyl)methyl]-2-methylthiophene |
|---|---|
| PubChem CID | 102835931 |
| Molecular Formula | C12H7Br2F3S |
| Molecular Weight | 400.06 g/mol |
| Exact Mass | 397.86 |
| IUPAC Name | 3-bromo-5-[bromo-(3,4,5-trifluorophenyl)methyl]-2-methylthiophene |
| SMILES | Cc1sc(C(Br)c2cc(F)c(F)c(F)c2)cc1Br |
| InChI | InChI=1S/C12H7Br2F3S/c1-5-7(13)4-10(18-5)11(14)6-2-8(15)12(17)9(16)3-6/h2-4,11H,1H3 |
| InChIKey | SCUXXVUXKPGTMN-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.06 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|