C13H10Br2F2S — CID 102835742
3-bromo-5-[bromo-(2,6-difluoro-3-methylphenyl)methyl]-2-methylthiophene (PubChem CID 102835742) has the molecular formula C13H10Br2F2S and a molecular weight of 396.09 g/mol. Its IUPAC name is 3-bromo-5-[bromo-(2,6-difluoro-3-methylphenyl)methyl]-2-methylthiophene.
| Compound Name | 3-bromo-5-[bromo-(2,6-difluoro-3-methylphenyl)methyl]-2-methylthiophene |
|---|---|
| PubChem CID | 102835742 |
| Molecular Formula | C13H10Br2F2S |
| Molecular Weight | 396.09 g/mol |
| Exact Mass | 393.88 |
| IUPAC Name | 3-bromo-5-[bromo-(2,6-difluoro-3-methylphenyl)methyl]-2-methylthiophene |
| SMILES | Cc1ccc(F)c(C(Br)c2cc(Br)c(C)s2)c1F |
| InChI | InChI=1S/C13H10Br2F2S/c1-6-3-4-9(16)11(13(6)17)12(15)10-5-8(14)7(2)18-10/h3-5,12H,1-2H3 |
| InChIKey | OUXTXFWCLWGXPL-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.09 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|