C14H13BrF2S — CID 82816050
2-[bromo-(2,6-difluoro-3-methylphenyl)methyl]-3,5-dimethylthiophene (PubChem CID 82816050) has the molecular formula C14H13BrF2S and a molecular weight of 331.23 g/mol. Its IUPAC name is 2-[bromo-(2,6-difluoro-3-methylphenyl)methyl]-3,5-dimethylthiophene.
| Compound Name | 2-[bromo-(2,6-difluoro-3-methylphenyl)methyl]-3,5-dimethylthiophene |
|---|---|
| PubChem CID | 82816050 |
| Molecular Formula | C14H13BrF2S |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 2-[bromo-(2,6-difluoro-3-methylphenyl)methyl]-3,5-dimethylthiophene |
| SMILES | Cc1cc(C)c(C(Br)c2c(F)ccc(C)c2F)s1 |
| InChI | InChI=1S/C14H13BrF2S/c1-7-4-5-10(16)11(13(7)17)12(15)14-8(2)6-9(3)18-14/h4-6,12H,1-3H3 |
| InChIKey | CWQXWNUITGDMMC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|