C6H3Br2ClF2S — CID 103514684
3-bromo-5-(1-bromo-2,2-difluoroethyl)-2-chlorothiophene (PubChem CID 103514684) has the molecular formula C6H3Br2ClF2S and a molecular weight of 340.41 g/mol. Its IUPAC name is 3-bromo-5-(1-bromo-2,2-difluoroethyl)-2-chlorothiophene.
| Compound Name | 3-bromo-5-(1-bromo-2,2-difluoroethyl)-2-chlorothiophene |
|---|---|
| PubChem CID | 103514684 |
| Molecular Formula | C6H3Br2ClF2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 337.80 |
| IUPAC Name | 3-bromo-5-(1-bromo-2,2-difluoroethyl)-2-chlorothiophene |
| SMILES | FC(F)C(Br)c1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C6H3Br2ClF2S/c7-2-1-3(12-5(2)9)4(8)6(10)11/h1,4,6H |
| InChIKey | JJSRJKLGQOROKN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|