C7H9BrClNS — CID 102828282
1-(4-bromo-5-chlorothiophen-2-yl)-N-methylethanamine (PubChem CID 102828282) has the molecular formula C7H9BrClNS and a molecular weight of 254.58 g/mol. Its IUPAC name is 1-(4-bromo-5-chlorothiophen-2-yl)-N-methylethanamine.
| Compound Name | 1-(4-bromo-5-chlorothiophen-2-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 102828282 |
| Molecular Formula | C7H9BrClNS |
| Molecular Weight | 254.58 g/mol |
| Exact Mass | 252.93 |
| IUPAC Name | 1-(4-bromo-5-chlorothiophen-2-yl)-N-methylethanamine |
| SMILES | CNC(C)c1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C7H9BrClNS/c1-4(10-2)6-3-5(8)7(9)11-6/h3-4,10H,1-2H3 |
| InChIKey | ASKNHMCUXFBZBL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.58 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |