C13H19BrClNS — CID 102828405
1-(4-bromo-5-chlorothiophen-2-yl)-N-methyl-1-(4-methylcyclohexyl)methanamine (PubChem CID 102828405) has the molecular formula C13H19BrClNS and a molecular weight of 336.73 g/mol. Its IUPAC name is 1-(4-bromo-5-chlorothiophen-2-yl)-N-methyl-1-(4-methylcyclohexyl)methanamine.
| Compound Name | 1-(4-bromo-5-chlorothiophen-2-yl)-N-methyl-1-(4-methylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 102828405 |
| Molecular Formula | C13H19BrClNS |
| Molecular Weight | 336.73 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 1-(4-bromo-5-chlorothiophen-2-yl)-N-methyl-1-(4-methylcyclohexyl)methanamine |
| SMILES | CNC(c1cc(Br)c(Cl)s1)C1CCC(C)CC1 |
| InChI | InChI=1S/C13H19BrClNS/c1-8-3-5-9(6-4-8)12(16-2)11-7-10(14)13(15)17-11/h7-9,12,16H,3-6H2,1-2H3 |
| InChIKey | ONCPQAWXQSPFHC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.73 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |