C12H17BrClNS — CID 102828558
N-[(4-bromo-5-chlorothiophen-2-yl)-cyclopentylmethyl]ethanamine (PubChem CID 102828558) has the molecular formula C12H17BrClNS and a molecular weight of 322.70 g/mol. Its IUPAC name is N-[(4-bromo-5-chlorothiophen-2-yl)-cyclopentylmethyl]ethanamine.
| Compound Name | N-[(4-bromo-5-chlorothiophen-2-yl)-cyclopentylmethyl]ethanamine |
|---|---|
| PubChem CID | 102828558 |
| Molecular Formula | C12H17BrClNS |
| Molecular Weight | 322.70 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | N-[(4-bromo-5-chlorothiophen-2-yl)-cyclopentylmethyl]ethanamine |
| SMILES | CCNC(c1cc(Br)c(Cl)s1)C1CCCC1 |
| InChI | InChI=1S/C12H17BrClNS/c1-2-15-11(8-5-3-4-6-8)10-7-9(13)12(14)16-10/h7-8,11,15H,2-6H2,1H3 |
| InChIKey | HYNROYXTIQQEFX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.70 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |