C11H16ClNS — CID 102763969
N-[(5-chloro-4-methylthiophen-2-yl)-cyclopropylmethyl]ethanamine (PubChem CID 102763969) has the molecular formula C11H16ClNS and a molecular weight of 229.78 g/mol. Its IUPAC name is N-[(5-chloro-4-methylthiophen-2-yl)-cyclopropylmethyl]ethanamine.
| Compound Name | N-[(5-chloro-4-methylthiophen-2-yl)-cyclopropylmethyl]ethanamine |
|---|---|
| PubChem CID | 102763969 |
| Molecular Formula | C11H16ClNS |
| Molecular Weight | 229.78 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | N-[(5-chloro-4-methylthiophen-2-yl)-cyclopropylmethyl]ethanamine |
| SMILES | CCNC(c1cc(C)c(Cl)s1)C1CC1 |
| InChI | InChI=1S/C11H16ClNS/c1-3-13-10(8-4-5-8)9-6-7(2)11(12)14-9/h6,8,10,13H,3-5H2,1-2H3 |
| InChIKey | BDJJUBZGCWKMHH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |