C18H30ClNS — CID 102763864
N-[(4-butylcyclohexyl)-(5-chloro-4-methylthiophen-2-yl)methyl]ethanamine (PubChem CID 102763864) has the molecular formula C18H30ClNS and a molecular weight of 327.97 g/mol. Its IUPAC name is N-[(4-butylcyclohexyl)-(5-chloro-4-methylthiophen-2-yl)methyl]ethanamine.
| Compound Name | N-[(4-butylcyclohexyl)-(5-chloro-4-methylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 102763864 |
| Molecular Formula | C18H30ClNS |
| Molecular Weight | 327.97 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N-[(4-butylcyclohexyl)-(5-chloro-4-methylthiophen-2-yl)methyl]ethanamine |
| SMILES | CCCCC1CCC(C(NCC)c2cc(C)c(Cl)s2)CC1 |
| InChI | InChI=1S/C18H30ClNS/c1-4-6-7-14-8-10-15(11-9-14)17(20-5-2)16-12-13(3)18(19)21-16/h12,14-15,17,20H,4-11H2,1-3H3 |
| InChIKey | HOCPGBFMYAMDRK-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.97 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |