C17H21NS — CID 43288356
N-[cyclopropyl-[5-(2-methylphenyl)thiophen-2-yl]methyl]ethanamine (PubChem CID 43288356) has the molecular formula C17H21NS and a molecular weight of 271.43 g/mol. Its IUPAC name is N-[cyclopropyl-[5-(2-methylphenyl)thiophen-2-yl]methyl]ethanamine.
| Compound Name | N-[cyclopropyl-[5-(2-methylphenyl)thiophen-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 43288356 |
| Molecular Formula | C17H21NS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-[cyclopropyl-[5-(2-methylphenyl)thiophen-2-yl]methyl]ethanamine |
| SMILES | CCNC(c1ccc(-c2ccccc2C)s1)C1CC1 |
| InChI | InChI=1S/C17H21NS/c1-3-18-17(13-8-9-13)16-11-10-15(19-16)14-7-5-4-6-12(14)2/h4-7,10-11,13,17-18H,3,8-9H2,1-2H3 |
| InChIKey | YHENZBQIGMKYAF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |