C19H30ClN — CID 107560350
N-[(3-chloro-4-methylphenyl)-(4-propylcyclohexyl)methyl]ethanamine (PubChem CID 107560350) has the molecular formula C19H30ClN and a molecular weight of 307.91 g/mol. Its IUPAC name is N-[(3-chloro-4-methylphenyl)-(4-propylcyclohexyl)methyl]ethanamine.
| Compound Name | N-[(3-chloro-4-methylphenyl)-(4-propylcyclohexyl)methyl]ethanamine |
|---|---|
| PubChem CID | 107560350 |
| Molecular Formula | C19H30ClN |
| Molecular Weight | 307.91 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | N-[(3-chloro-4-methylphenyl)-(4-propylcyclohexyl)methyl]ethanamine |
| SMILES | CCCC1CCC(C(NCC)c2ccc(C)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H30ClN/c1-4-6-15-8-11-16(12-9-15)19(21-5-2)17-10-7-14(3)18(20)13-17/h7,10,13,15-16,19,21H,4-6,8-9,11-12H2,1-3H3 |
| InChIKey | JWDGJXUPNWXQIZ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.91 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |