C17H27ClN2 — CID 107562364
[(3-chloro-4-methylphenyl)-(4-propylcyclohexyl)methyl]hydrazine (PubChem CID 107562364) has the molecular formula C17H27ClN2 and a molecular weight of 294.87 g/mol. Its IUPAC name is [(3-chloro-4-methylphenyl)-(4-propylcyclohexyl)methyl]hydrazine.
| Compound Name | [(3-chloro-4-methylphenyl)-(4-propylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 107562364 |
| Molecular Formula | C17H27ClN2 |
| Molecular Weight | 294.87 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | [(3-chloro-4-methylphenyl)-(4-propylcyclohexyl)methyl]hydrazine |
| SMILES | CCCC1CCC(C(NN)c2ccc(C)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H27ClN2/c1-3-4-13-6-9-14(10-7-13)17(20-19)15-8-5-12(2)16(18)11-15/h5,8,11,13-14,17,20H,3-4,6-7,9-10,19H2,1-2H3 |
| InChIKey | WGTJDMOLVZOTFH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.87 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|