C16H24Cl2N2 — CID 105232276
[(2,3-dichlorophenyl)-(4-propylcyclohexyl)methyl]hydrazine (PubChem CID 105232276) has the molecular formula C16H24Cl2N2 and a molecular weight of 315.29 g/mol. Its IUPAC name is [(2,3-dichlorophenyl)-(4-propylcyclohexyl)methyl]hydrazine.
| Compound Name | [(2,3-dichlorophenyl)-(4-propylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105232276 |
| Molecular Formula | C16H24Cl2N2 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | [(2,3-dichlorophenyl)-(4-propylcyclohexyl)methyl]hydrazine |
| SMILES | CCCC1CCC(C(NN)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C16H24Cl2N2/c1-2-4-11-7-9-12(10-8-11)16(20-19)13-5-3-6-14(17)15(13)18/h3,5-6,11-12,16,20H,2,4,7-10,19H2,1H3 |
| InChIKey | LIHHPDLRVNTXNA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|