C11H15BrClNOS — CID 102828280
1-(4-bromo-5-chlorothiophen-2-yl)-N-methyl-1-(5-methyloxolan-3-yl)methanamine (PubChem CID 102828280) has the molecular formula C11H15BrClNOS and a molecular weight of 324.67 g/mol. Its IUPAC name is 1-(4-bromo-5-chlorothiophen-2-yl)-N-methyl-1-(5-methyloxolan-3-yl)methanamine.
| Compound Name | 1-(4-bromo-5-chlorothiophen-2-yl)-N-methyl-1-(5-methyloxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 102828280 |
| Molecular Formula | C11H15BrClNOS |
| Molecular Weight | 324.67 g/mol |
| Exact Mass | 322.97 |
| IUPAC Name | 1-(4-bromo-5-chlorothiophen-2-yl)-N-methyl-1-(5-methyloxolan-3-yl)methanamine |
| SMILES | CNC(c1cc(Br)c(Cl)s1)C1COC(C)C1 |
| InChI | InChI=1S/C11H15BrClNOS/c1-6-3-7(5-15-6)10(14-2)9-4-8(12)11(13)16-9/h4,6-7,10,14H,3,5H2,1-2H3 |
| InChIKey | AESSRMWJFGOYRF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.67 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |