C12H10BrCl2NS — CID 102828263
1-(4-bromo-5-chlorothiophen-2-yl)-1-(2-chlorophenyl)-N-methylmethanamine (PubChem CID 102828263) has the molecular formula C12H10BrCl2NS and a molecular weight of 351.10 g/mol. Its IUPAC name is 1-(4-bromo-5-chlorothiophen-2-yl)-1-(2-chlorophenyl)-N-methylmethanamine.
| Compound Name | 1-(4-bromo-5-chlorothiophen-2-yl)-1-(2-chlorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 102828263 |
| Molecular Formula | C12H10BrCl2NS |
| Molecular Weight | 351.10 g/mol |
| Exact Mass | 348.91 |
| IUPAC Name | 1-(4-bromo-5-chlorothiophen-2-yl)-1-(2-chlorophenyl)-N-methylmethanamine |
| SMILES | CNC(c1cc(Br)c(Cl)s1)c1ccccc1Cl |
| InChI | InChI=1S/C12H10BrCl2NS/c1-16-11(7-4-2-3-5-9(7)14)10-6-8(13)12(15)17-10/h2-6,11,16H,1H3 |
| InChIKey | FQFZDSMQSNJMJS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.10 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |