C12H9BrCl2INS — CID 103220625
1-(4-bromo-5-chlorothiophen-2-yl)-1-(3-chloro-4-iodophenyl)-N-methylmethanamine (PubChem CID 103220625) has the molecular formula C12H9BrCl2INS and a molecular weight of 476.99 g/mol. Its IUPAC name is 1-(4-bromo-5-chlorothiophen-2-yl)-1-(3-chloro-4-iodophenyl)-N-methylmethanamine.
| Compound Name | 1-(4-bromo-5-chlorothiophen-2-yl)-1-(3-chloro-4-iodophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 103220625 |
| Molecular Formula | C12H9BrCl2INS |
| Molecular Weight | 476.99 g/mol |
| Exact Mass | 474.81 |
| IUPAC Name | 1-(4-bromo-5-chlorothiophen-2-yl)-1-(3-chloro-4-iodophenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(I)c(Cl)c1)c1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C12H9BrCl2INS/c1-17-11(10-5-7(13)12(15)18-10)6-2-3-9(16)8(14)4-6/h2-5,11,17H,1H3 |
| InChIKey | VKNYFHGMHBQZJE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.99 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|