C12H10BrClINS — CID 80531186
1-(5-bromo-4-chlorothiophen-2-yl)-1-(4-iodophenyl)-N-methylmethanamine (PubChem CID 80531186) has the molecular formula C12H10BrClINS and a molecular weight of 442.55 g/mol. Its IUPAC name is 1-(5-bromo-4-chlorothiophen-2-yl)-1-(4-iodophenyl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-4-chlorothiophen-2-yl)-1-(4-iodophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 80531186 |
| Molecular Formula | C12H10BrClINS |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 440.85 |
| IUPAC Name | 1-(5-bromo-4-chlorothiophen-2-yl)-1-(4-iodophenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(I)cc1)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C12H10BrClINS/c1-16-11(7-2-4-8(15)5-3-7)10-6-9(14)12(13)17-10/h2-6,11,16H,1H3 |
| InChIKey | XKZVCKHXPMSZCL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|