C10H8Br2ClNS2 — CID 80530701
1-(5-bromo-4-chlorothiophen-2-yl)-1-(3-bromothiophen-2-yl)-N-methylmethanamine (PubChem CID 80530701) has the molecular formula C10H8Br2ClNS2 and a molecular weight of 401.58 g/mol. Its IUPAC name is 1-(5-bromo-4-chlorothiophen-2-yl)-1-(3-bromothiophen-2-yl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-4-chlorothiophen-2-yl)-1-(3-bromothiophen-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 80530701 |
| Molecular Formula | C10H8Br2ClNS2 |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 398.82 |
| IUPAC Name | 1-(5-bromo-4-chlorothiophen-2-yl)-1-(3-bromothiophen-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc(Cl)c(Br)s1)c1sccc1Br |
| InChI | InChI=1S/C10H8Br2ClNS2/c1-14-8(9-5(11)2-3-15-9)7-4-6(13)10(12)16-7/h2-4,8,14H,1H3 |
| InChIKey | PIEIPLGQSNUVQA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |