C8H8BrN3S2 — CID 105173140
1-(3-bromothiophen-2-yl)-N-methyl-1-(thiadiazol-5-yl)methanamine (PubChem CID 105173140) has the molecular formula C8H8BrN3S2 and a molecular weight of 290.21 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-N-methyl-1-(thiadiazol-5-yl)methanamine.
| Compound Name | 1-(3-bromothiophen-2-yl)-N-methyl-1-(thiadiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 105173140 |
| Molecular Formula | C8H8BrN3S2 |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 288.93 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-N-methyl-1-(thiadiazol-5-yl)methanamine |
| SMILES | CNC(c1cnns1)c1sccc1Br |
| InChI | InChI=1S/C8H8BrN3S2/c1-10-7(6-4-11-12-14-6)8-5(9)2-3-13-8/h2-4,7,10H,1H3 |
| InChIKey | RWXQOAFRMVFDAX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |