C7H9BrN6S — CID 106464914
1-(5-bromo-3-methyltriazol-4-yl)-N-methyl-1-(thiadiazol-5-yl)methanamine (PubChem CID 106464914) has the molecular formula C7H9BrN6S and a molecular weight of 289.16 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)-N-methyl-1-(thiadiazol-5-yl)methanamine.
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)-N-methyl-1-(thiadiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 106464914 |
| Molecular Formula | C7H9BrN6S |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)-N-methyl-1-(thiadiazol-5-yl)methanamine |
| SMILES | CNC(c1cnns1)c1c(Br)nnn1C |
| InChI | InChI=1S/C7H9BrN6S/c1-9-5(4-3-10-13-15-4)6-7(8)11-12-14(6)2/h3,5,9H,1-2H3 |
| InChIKey | AENTVQMWRLVLSF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |