C12H17BrN6 — CID 106465124
1-(5-bromo-3-methyltriazol-4-yl)-1-(3-ethyl-6-methylpyridazin-4-yl)-N-methylmethanamine (PubChem CID 106465124) has the molecular formula C12H17BrN6 and a molecular weight of 325.21 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)-1-(3-ethyl-6-methylpyridazin-4-yl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)-1-(3-ethyl-6-methylpyridazin-4-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 106465124 |
| Molecular Formula | C12H17BrN6 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)-1-(3-ethyl-6-methylpyridazin-4-yl)-N-methylmethanamine |
| SMILES | CCc1nnc(C)cc1C(NC)c1c(Br)nnn1C |
| InChI | InChI=1S/C12H17BrN6/c1-5-9-8(6-7(2)15-16-9)10(14-3)11-12(13)17-18-19(11)4/h6,10,14H,5H2,1-4H3 |
| InChIKey | PYQSEHKXOINROF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |