C12H19BrN6 — CID 106465134
N-[(5-bromo-3-methyltriazol-4-yl)-(2-ethyl-5-methylpyrazol-3-yl)methyl]ethanamine (PubChem CID 106465134) has the molecular formula C12H19BrN6 and a molecular weight of 327.23 g/mol. Its IUPAC name is N-[(5-bromo-3-methyltriazol-4-yl)-(2-ethyl-5-methylpyrazol-3-yl)methyl]ethanamine.
| Compound Name | N-[(5-bromo-3-methyltriazol-4-yl)-(2-ethyl-5-methylpyrazol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106465134 |
| Molecular Formula | C12H19BrN6 |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-[(5-bromo-3-methyltriazol-4-yl)-(2-ethyl-5-methylpyrazol-3-yl)methyl]ethanamine |
| SMILES | CCNC(c1c(Br)nnn1C)c1cc(C)nn1CC |
| InChI | InChI=1S/C12H19BrN6/c1-5-14-10(11-12(13)15-17-18(11)4)9-7-8(3)16-19(9)6-2/h7,10,14H,5-6H2,1-4H3 |
| InChIKey | DTGNQFVWTIZAQK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |