C8H15BrN4 — CID 106462146
1-(5-bromo-3-methyltriazol-4-yl)-N-ethylpropan-1-amine (PubChem CID 106462146) has the molecular formula C8H15BrN4 and a molecular weight of 247.14 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)-N-ethylpropan-1-amine.
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 106462146 |
| Molecular Formula | C8H15BrN4 |
| Molecular Weight | 247.14 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)-N-ethylpropan-1-amine |
| SMILES | CCNC(CC)c1c(Br)nnn1C |
| InChI | InChI=1S/C8H15BrN4/c1-4-6(10-5-2)7-8(9)11-12-13(7)3/h6,10H,4-5H2,1-3H3 |
| InChIKey | LGWXZTRGSGCKAV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.14 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |