C9H15BrN4 — CID 106462953
1-(5-bromo-3-methyltriazol-4-yl)-N-ethylbut-3-en-1-amine (PubChem CID 106462953) has the molecular formula C9H15BrN4 and a molecular weight of 259.15 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)-N-ethylbut-3-en-1-amine.
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)-N-ethylbut-3-en-1-amine |
|---|---|
| PubChem CID | 106462953 |
| Molecular Formula | C9H15BrN4 |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)-N-ethylbut-3-en-1-amine |
| SMILES | C=CCC(NCC)c1c(Br)nnn1C |
| InChI | InChI=1S/C9H15BrN4/c1-4-6-7(11-5-2)8-9(10)12-13-14(8)3/h4,7,11H,1,5-6H2,2-3H3 |
| InChIKey | LFWQOKAHXSPXPU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|