C13H16Br2N4S — CID 106462592
1-(5-bromo-3-methyltriazol-4-yl)-2-(2-bromophenyl)sulfanyl-N-ethylethanamine (PubChem CID 106462592) has the molecular formula C13H16Br2N4S and a molecular weight of 420.17 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)-2-(2-bromophenyl)sulfanyl-N-ethylethanamine.
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)-2-(2-bromophenyl)sulfanyl-N-ethylethanamine |
|---|---|
| PubChem CID | 106462592 |
| Molecular Formula | C13H16Br2N4S |
| Molecular Weight | 420.17 g/mol |
| Exact Mass | 417.95 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)-2-(2-bromophenyl)sulfanyl-N-ethylethanamine |
| SMILES | CCNC(CSc1ccccc1Br)c1c(Br)nnn1C |
| InChI | InChI=1S/C13H16Br2N4S/c1-3-16-10(12-13(15)17-18-19(12)2)8-20-11-7-5-4-6-9(11)14/h4-7,10,16H,3,8H2,1-2H3 |
| InChIKey | MEDVNBVXCRAWLG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.17 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |