C12H13Br2FN4 — CID 106463074
N-[(2-bromo-6-fluorophenyl)-(5-bromo-3-methyltriazol-4-yl)methyl]ethanamine (PubChem CID 106463074) has the molecular formula C12H13Br2FN4 and a molecular weight of 392.07 g/mol. Its IUPAC name is N-[(2-bromo-6-fluorophenyl)-(5-bromo-3-methyltriazol-4-yl)methyl]ethanamine.
| Compound Name | N-[(2-bromo-6-fluorophenyl)-(5-bromo-3-methyltriazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106463074 |
| Molecular Formula | C12H13Br2FN4 |
| Molecular Weight | 392.07 g/mol |
| Exact Mass | 389.95 |
| IUPAC Name | N-[(2-bromo-6-fluorophenyl)-(5-bromo-3-methyltriazol-4-yl)methyl]ethanamine |
| SMILES | CCNC(c1c(F)cccc1Br)c1c(Br)nnn1C |
| InChI | InChI=1S/C12H13Br2FN4/c1-3-16-10(11-12(14)17-18-19(11)2)9-7(13)5-4-6-8(9)15/h4-6,10,16H,3H2,1-2H3 |
| InChIKey | AKIAQCKFIMURKG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.07 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |