C13H16Br2N4 — CID 106465338
N-[(3-bromo-2-methylphenyl)-(5-bromo-3-methyltriazol-4-yl)methyl]ethanamine (PubChem CID 106465338) has the molecular formula C13H16Br2N4 and a molecular weight of 388.11 g/mol. Its IUPAC name is N-[(3-bromo-2-methylphenyl)-(5-bromo-3-methyltriazol-4-yl)methyl]ethanamine.
| Compound Name | N-[(3-bromo-2-methylphenyl)-(5-bromo-3-methyltriazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106465338 |
| Molecular Formula | C13H16Br2N4 |
| Molecular Weight | 388.11 g/mol |
| Exact Mass | 385.97 |
| IUPAC Name | N-[(3-bromo-2-methylphenyl)-(5-bromo-3-methyltriazol-4-yl)methyl]ethanamine |
| SMILES | CCNC(c1cccc(Br)c1C)c1c(Br)nnn1C |
| InChI | InChI=1S/C13H16Br2N4/c1-4-16-11(12-13(15)17-18-19(12)3)9-6-5-7-10(14)8(9)2/h5-7,11,16H,4H2,1-3H3 |
| InChIKey | PPARTTAHCCTZPE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.11 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |