C12H13BrClFN4 — CID 106463071
N-[(5-bromo-3-methyltriazol-4-yl)-(5-chloro-2-fluorophenyl)methyl]ethanamine (PubChem CID 106463071) has the molecular formula C12H13BrClFN4 and a molecular weight of 347.62 g/mol. Its IUPAC name is N-[(5-bromo-3-methyltriazol-4-yl)-(5-chloro-2-fluorophenyl)methyl]ethanamine.
| Compound Name | N-[(5-bromo-3-methyltriazol-4-yl)-(5-chloro-2-fluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 106463071 |
| Molecular Formula | C12H13BrClFN4 |
| Molecular Weight | 347.62 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | N-[(5-bromo-3-methyltriazol-4-yl)-(5-chloro-2-fluorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1cc(Cl)ccc1F)c1c(Br)nnn1C |
| InChI | InChI=1S/C12H13BrClFN4/c1-3-16-10(11-12(13)17-18-19(11)2)8-6-7(14)4-5-9(8)15/h4-6,10,16H,3H2,1-2H3 |
| InChIKey | QXZFQPOYEJOORP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |