C14H18BrFN4 — CID 106462267
N-[(5-bromo-3-methyltriazol-4-yl)-(5-fluoro-2-methylphenyl)methyl]propan-1-amine (PubChem CID 106462267) has the molecular formula C14H18BrFN4 and a molecular weight of 341.23 g/mol. Its IUPAC name is N-[(5-bromo-3-methyltriazol-4-yl)-(5-fluoro-2-methylphenyl)methyl]propan-1-amine.
| Compound Name | N-[(5-bromo-3-methyltriazol-4-yl)-(5-fluoro-2-methylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106462267 |
| Molecular Formula | C14H18BrFN4 |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | N-[(5-bromo-3-methyltriazol-4-yl)-(5-fluoro-2-methylphenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cc(F)ccc1C)c1c(Br)nnn1C |
| InChI | InChI=1S/C14H18BrFN4/c1-4-7-17-12(13-14(15)18-19-20(13)3)11-8-10(16)6-5-9(11)2/h5-6,8,12,17H,4,7H2,1-3H3 |
| InChIKey | CNNJCEGYBAKZHX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |