C11H15BrN4O — CID 106462297
N-[(5-bromo-3-methyltriazol-4-yl)-(furan-2-yl)methyl]propan-1-amine (PubChem CID 106462297) has the molecular formula C11H15BrN4O and a molecular weight of 299.17 g/mol. Its IUPAC name is N-[(5-bromo-3-methyltriazol-4-yl)-(furan-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(5-bromo-3-methyltriazol-4-yl)-(furan-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106462297 |
| Molecular Formula | C11H15BrN4O |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | N-[(5-bromo-3-methyltriazol-4-yl)-(furan-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccco1)c1c(Br)nnn1C |
| InChI | InChI=1S/C11H15BrN4O/c1-3-6-13-9(8-5-4-7-17-8)10-11(12)14-15-16(10)2/h4-5,7,9,13H,3,6H2,1-2H3 |
| InChIKey | KSANFJKUJKWCPV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |