C14H18BrFN4S — CID 106462568
N-[1-(5-bromo-3-methyltriazol-4-yl)-2-(4-fluorophenyl)sulfanylethyl]propan-1-amine (PubChem CID 106462568) has the molecular formula C14H18BrFN4S and a molecular weight of 373.30 g/mol. Its IUPAC name is N-[1-(5-bromo-3-methyltriazol-4-yl)-2-(4-fluorophenyl)sulfanylethyl]propan-1-amine.
| Compound Name | N-[1-(5-bromo-3-methyltriazol-4-yl)-2-(4-fluorophenyl)sulfanylethyl]propan-1-amine |
|---|---|
| PubChem CID | 106462568 |
| Molecular Formula | C14H18BrFN4S |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | N-[1-(5-bromo-3-methyltriazol-4-yl)-2-(4-fluorophenyl)sulfanylethyl]propan-1-amine |
| SMILES | CCCNC(CSc1ccc(F)cc1)c1c(Br)nnn1C |
| InChI | InChI=1S/C14H18BrFN4S/c1-3-8-17-12(13-14(15)18-19-20(13)2)9-21-11-6-4-10(16)5-7-11/h4-7,12,17H,3,8-9H2,1-2H3 |
| InChIKey | DQFGYOYQVBBHGO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |