C12H14BrFN4S — CID 106462563
1-(5-bromo-3-methyltriazol-4-yl)-2-(3-fluorophenyl)sulfanyl-N-methylethanamine (PubChem CID 106462563) has the molecular formula C12H14BrFN4S and a molecular weight of 345.24 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)-2-(3-fluorophenyl)sulfanyl-N-methylethanamine.
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)-2-(3-fluorophenyl)sulfanyl-N-methylethanamine |
|---|---|
| PubChem CID | 106462563 |
| Molecular Formula | C12H14BrFN4S |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)-2-(3-fluorophenyl)sulfanyl-N-methylethanamine |
| SMILES | CNC(CSc1cccc(F)c1)c1c(Br)nnn1C |
| InChI | InChI=1S/C12H14BrFN4S/c1-15-10(11-12(13)16-17-18(11)2)7-19-9-5-3-4-8(14)6-9/h3-6,10,15H,7H2,1-2H3 |
| InChIKey | QSCNBNLBWYTEJL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |