C15H15BrFNS — CID 66055898
2-(4-bromophenyl)sulfanyl-1-(3-fluorophenyl)-N-methylethanamine (PubChem CID 66055898) has the molecular formula C15H15BrFNS and a molecular weight of 340.26 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-1-(3-fluorophenyl)-N-methylethanamine.
| Compound Name | 2-(4-bromophenyl)sulfanyl-1-(3-fluorophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 66055898 |
| Molecular Formula | C15H15BrFNS |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-1-(3-fluorophenyl)-N-methylethanamine |
| SMILES | CNC(CSc1ccc(Br)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C15H15BrFNS/c1-18-15(11-3-2-4-13(17)9-11)10-19-14-7-5-12(16)6-8-14/h2-9,15,18H,10H2,1H3 |
| InChIKey | DDZJECQFGQPYRK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |